CAS 2904673-96-5 is the registry number for 3-Hydroxy Niclosamide (>90%). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
5-chloro-N-(2-chloro-4-nitrophenyl)-2,3-dihydroxybenzamide (CAS 2904673-96-5) is a chemical compound with the molecular formula C13H8Cl2N2O5 and a molecular weight of 343.12 g/mol. IUPAC name: 5-chloro-N-(2-chloro-4-nitrophenyl)-2,3-dihydroxybenzamide. InChIKey: CFBQBYWTAGJVFT-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2O5 |
|---|---|
| Molecular weight | 343.12 g/mol |
| IUPAC name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2,3-dihydroxybenzamide |
| InChIKey | CFBQBYWTAGJVFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)C2=C(C(=CC(=C2)Cl)O)O |
Computed by PubChem (NCBI)