Products 2907651-12-9
CAS 2907651-12-9 is the registry number for 4-Bromo-1-(3,3-difluorocyclobutyl)-1H-pyrazole, >95%. Offered by: Chemat. Available pack sizes: 100mg.
4-bromo-1-(3,3-difluorocyclobutyl)pyrazole (CAS 2907651-12-9) is a chemical compound with the molecular formula C7H7BrF2N2 and a molecular weight of 237.04 g/mol. IUPAC name: 4-bromo-1-(3,3-difluorocyclobutyl)pyrazole. InChIKey: DNUZWOVJKFXGEF-UHFFFAOYSA-N.
| Molecular formula | C7H7BrF2N2 |
|---|---|
| Molecular weight | 237.04 g/mol |
| IUPAC name | 4-bromo-1-(3,3-difluorocyclobutyl)pyrazole |
| InChIKey | DNUZWOVJKFXGEF-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)N2C=C(C=N2)Br |
Computed by PubChem (NCBI)