Products 1381944-38-2

CAS 1381944-38-2 is the registry number for 4-Bromo-5,6-difluoro-1-N-methylbenzene-1,2-diamine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-bromo-3,4-difluoro-2-N-methylbenzene-1,2-diamine (CAS 1381944-38-2) is a chemical compound with the molecular formula C7H7BrF2N2 and a molecular weight of 237.04 g/mol. IUPAC name: 5-bromo-3,4-difluoro-2-N-methylbenzene-1,2-diamine. InChIKey: MDQHTXCGSHNVFE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BrF2N2
Molecular weight237.04 g/mol
IUPAC name5-bromo-3,4-difluoro-2-N-methylbenzene-1,2-diamine
InChIKeyMDQHTXCGSHNVFE-UHFFFAOYSA-N
SMILESCNC1=C(C(=C(C=C1N)Br)F)F

Computed by PubChem (NCBI)