Products 2907774-88-1
CAS 2907774-88-1 is the registry number for Anticancer agent 30. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3Z)-3-[(4-chlorophenyl)methylidene]-1-[(4-fluorophenyl)methyl]indol-2-one (CAS 2907774-88-1) is a chemical compound with the molecular formula C22H15ClFNO and a molecular weight of 363.8 g/mol. IUPAC name: (3Z)-3-[(4-chlorophenyl)methylidene]-1-[(4-fluorophenyl)methyl]indol-2-one. InChIKey: PFHUFWNFTOQYSB-MOSHPQCFSA-N.
| Molecular formula | C22H15ClFNO |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | (3Z)-3-[(4-chlorophenyl)methylidene]-1-[(4-fluorophenyl)methyl]indol-2-one |
| InChIKey | PFHUFWNFTOQYSB-MOSHPQCFSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C3=CC=C(C=C3)Cl)/C(=O)N2CC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 30