CAS 290835-35-7 is the registry number for N-((3,4-dimethoxyphenyl)methyl)-3-phenylprop-2-enamide. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenylprop-2-enamide (CAS 290835-35-7) is a chemical compound with the molecular formula C23H18N2OS and a molecular weight of 370.5 g/mol. IUPAC name: (E)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenylprop-2-enamide. InChIKey: VKRHCMKYGDBDPC-RIYZIHGNSA-N.
| Molecular formula | C23H18N2OS |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | (E)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-phenylprop-2-enamide |
| InChIKey | VKRHCMKYGDBDPC-RIYZIHGNSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)C3=CC=C(C=C3)NC(=O)/C=C/C4=CC=CC=C4 |
Computed by PubChem (NCBI)