CAS 29089-62-1 appears in our catalog under these names: Tetrabutylphosphonium tetraphenylborate, 98%, Tetrabutylphosphonium Tetraphenylborate, Tetrabutylphosphonium Tetraphenylborate, >98.0%(HPLC)(T), Tetrabutylphosphonium tetraphenylborate 98%, TETRABUTYLPHOSPHONIUM TETRAPHENYLBORATE, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 100g, 10g.
Tetrabutylphosphanium;tetraphenylboranuide (CAS 29089-62-1) is a chemical compound with the molecular formula C40H56BP and a molecular weight of 578.7 g/mol. IUPAC name: tetrabutylphosphanium;tetraphenylboranuide. InChIKey: OGWSZNMGVXKACZ-UHFFFAOYSA-N.
| Molecular formula | C40H56BP |
|---|---|
| Molecular weight | 578.7 g/mol |
| IUPAC name | tetrabutylphosphanium;tetraphenylboranuide |
| InChIKey | OGWSZNMGVXKACZ-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.CCCC[P+](CCCC)(CCCC)CCCC |
Computed by PubChem (NCBI)