CAS 29092-27-1 appears in our catalog under these names: 2,4,5-Trichlorobenzenesulfonamide, 97%, 2,4,5-Trichlorobenzenesulphonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
2,4,5-trichlorobenzenesulfonamide (CAS 29092-27-1) is a chemical compound with the molecular formula C6H4Cl3NO2S and a molecular weight of 260.5 g/mol. IUPAC name: 2,4,5-trichlorobenzenesulfonamide. InChIKey: GVOBBMKHUZFSHB-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO2S |
|---|---|
| Molecular weight | 260.5 g/mol |
| IUPAC name | 2,4,5-trichlorobenzenesulfonamide |
| InChIKey | GVOBBMKHUZFSHB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)