Products 29092-31-7

CAS 29092-31-7 is the registry number for 2-Nitro-4-sulfamoylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-nitro-4-sulfamoylbenzoic acid (CAS 29092-31-7) is a chemical compound with the molecular formula C7H6N2O6S and a molecular weight of 246.20 g/mol. IUPAC name: 2-nitro-4-sulfamoylbenzoic acid. InChIKey: DGRCSZFTPTUQGS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O6S
Molecular weight246.20 g/mol
IUPAC name2-nitro-4-sulfamoylbenzoic acid
InChIKeyDGRCSZFTPTUQGS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)N)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)