CAS 2909483-36-7 appears in our catalog under these names: Bim–IN–1, Bim-IN-1, 99%, 99%, Bim-IN-1, 99.57%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50 mg, 100 mg, 5 mg, 10mM/1mL.
1-[(2,4-dichlorophenyl)methylsulfonyl]-2-(3-fluorophenyl)azepane (CAS 2909483-36-7) is a chemical compound with the molecular formula C19H20Cl2FNO2S and a molecular weight of 416.3 g/mol. IUPAC name: 1-[(2,4-dichlorophenyl)methylsulfonyl]-2-(3-fluorophenyl)azepane. InChIKey: SFVNBTZMJWQDLM-UHFFFAOYSA-N.
| Molecular formula | C19H20Cl2FNO2S |
|---|---|
| Molecular weight | 416.3 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenyl)methylsulfonyl]-2-(3-fluorophenyl)azepane |
| InChIKey | SFVNBTZMJWQDLM-UHFFFAOYSA-N |
| SMILES | C1CCC(N(CC1)S(=O)(=O)CC2=C(C=C(C=C2)Cl)Cl)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)