CAS 29102-47-4 appears in our catalog under these names: Ifosfamide Impurity 5, Ifosfamide Impurity 12, Ethyleniminoifosfamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 50mg, 5mg.
2-(aziridin-1-yl)-3-(2-chloroethyl)-1,3,2lambda5-oxazaphosphinane 2-oxide (CAS 29102-47-4) is a chemical compound with the molecular formula C7H14ClN2O2P and a molecular weight of 224.62 g/mol. IUPAC name: 2-(aziridin-1-yl)-3-(2-chloroethyl)-1,3,2lambda5-oxazaphosphinane 2-oxide. InChIKey: ZIXPOIOWMASQOC-UHFFFAOYSA-N.
| Molecular formula | C7H14ClN2O2P |
|---|---|
| Molecular weight | 224.62 g/mol |
| IUPAC name | 2-(aziridin-1-yl)-3-(2-chloroethyl)-1,3,2lambda5-oxazaphosphinane 2-oxide |
| InChIKey | ZIXPOIOWMASQOC-UHFFFAOYSA-N |
| SMILES | C1CN(P(=O)(OC1)N2CC2)CCCl |
Computed by PubChem (NCBI)