Products 2910778-25-3
CAS 2910778-25-3 is the registry number for tert-Butyl (S)-(1-((5-bromothiophen-3-yl)oxy)propan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S)-1-(5-bromothiophen-3-yl)oxypropan-2-yl]carbamate (CAS 2910778-25-3) is a chemical compound with the molecular formula C12H18BrNO3S and a molecular weight of 336.25 g/mol. IUPAC name: tert-butyl N-[(2S)-1-(5-bromothiophen-3-yl)oxypropan-2-yl]carbamate. InChIKey: DJORVAMKTDPDFD-QMMMGPOBSA-N.
| Molecular formula | C12H18BrNO3S |
|---|---|
| Molecular weight | 336.25 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-(5-bromothiophen-3-yl)oxypropan-2-yl]carbamate |
| InChIKey | DJORVAMKTDPDFD-QMMMGPOBSA-N |
| SMILES | C[C@@H](COC1=CSC(=C1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)