Products 29113-63-1
CAS 29113-63-1 is the registry number for Ethyl 2,5-dimethyl-3-furoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2,5-dimethylfuran-3-carboxylate (CAS 29113-63-1) is a chemical compound with the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. IUPAC name: ethyl 2,5-dimethylfuran-3-carboxylate. InChIKey: DNYLSCDHFCSDRM-UHFFFAOYSA-N.
| Molecular formula | C9H12O3 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | ethyl 2,5-dimethylfuran-3-carboxylate |
| InChIKey | DNYLSCDHFCSDRM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=C1)C)C |
Computed by PubChem (NCBI)
Synonyms:
3-Furancarboxylic acid, 2,5-dimethyl-, ethyl ester, ethyl 2,5-dimethylfuran-3-carboxylate, ethyl 2,5-dimethyl-3-furoate, 2,5-dimethyl-furan-3-carboxylic acid ethyl ester, DNYLSCDHFCSDRM-UHFFFAOYSA-N, ethyl2,5-dimethylfuran-3-carboxylate, 2,5-dimethyl-3-furancarboxylic acid ethyl ester, InChI=1/C9H12O3/c1-4-11-9(10)8-5-6(2)12-7(8)3/h5H,4H2,1-3H