CAS 29114-93-0 is the registry number for 5,10,15,20–Tetra(3–methoxyphenyl)porphyrin. Offered by: GLPBio. Available pack sizes: 1g, 500mg, 5g.
5,10,15,20-tetrakis(3-methoxyphenyl)-21,23-dihydroporphyrin (CAS 29114-93-0) is a chemical compound with the molecular formula C48H38N4O4 and a molecular weight of 734.8 g/mol. IUPAC name: 5,10,15,20-tetrakis(3-methoxyphenyl)-21,23-dihydroporphyrin. InChIKey: DNMOKGCCGNYHJH-UHFFFAOYSA-N.
| Molecular formula | C48H38N4O4 |
|---|---|
| Molecular weight | 734.8 g/mol |
| IUPAC name | 5,10,15,20-tetrakis(3-methoxyphenyl)-21,23-dihydroporphyrin |
| InChIKey | DNMOKGCCGNYHJH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC(=CC=C7)OC)C8=CC(=CC=C8)OC)C=C4)C9=CC(=CC=C9)OC)N3 |
Computed by PubChem (NCBI)