Products 2911572-60-4
CAS 2911572-60-4 is the registry number for N-[1,1′:3′,1′′-terphenyl]-3-yl-3-Dibenzofuranamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[3-(3-phenylphenyl)phenyl]dibenzofuran-3-amine (CAS 2911572-60-4) is a chemical compound with the molecular formula C30H21NO and a molecular weight of 411.5 g/mol. IUPAC name: N-[3-(3-phenylphenyl)phenyl]dibenzofuran-3-amine. InChIKey: SHKJEYISOKAGKQ-UHFFFAOYSA-N.
| Molecular formula | C30H21NO |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | N-[3-(3-phenylphenyl)phenyl]dibenzofuran-3-amine |
| InChIKey | SHKJEYISOKAGKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC(=CC=C3)NC4=CC5=C(C=C4)C6=CC=CC=C6O5 |
Computed by PubChem (NCBI)