CAS 955959-89-4 appears in our catalog under these names: N-(4-(Dibenzo[b,d]furan-4-yl)phenyl)-[1,1'-biphenyl]-4-amine, 97%, N-(4-(Dibenzo[b,d]furan-4-yl)phenyl)-[1,1'-biphenyl]-4-amine, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g.
N-(4-dibenzofuran-4-ylphenyl)-4-phenylaniline (CAS 955959-89-4) is a chemical compound with the molecular formula C30H21NO and a molecular weight of 411.5 g/mol. IUPAC name: N-(4-dibenzofuran-4-ylphenyl)-4-phenylaniline. InChIKey: QLVJMUILAGEUOP-UHFFFAOYSA-N.
| Molecular formula | C30H21NO |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | N-(4-dibenzofuran-4-ylphenyl)-4-phenylaniline |
| InChIKey | QLVJMUILAGEUOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C4=CC=CC5=C4OC6=CC=CC=C56 |
Computed by PubChem (NCBI)