CAS 2911585-37-8 is the registry number for SILA-123. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-(3-amino-6-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)phenyl]-3-(4-tert-butylphenyl)urea (CAS 2911585-37-8) is a chemical compound with the molecular formula C24H25N5O2 and a molecular weight of 415.5 g/mol. IUPAC name: 1-[4-(3-amino-6-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)phenyl]-3-(4-tert-butylphenyl)urea. InChIKey: ZUXJIOLLSSLCOH-UHFFFAOYSA-N.
| Molecular formula | C24H25N5O2 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 1-[4-(3-amino-6-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl)phenyl]-3-(4-tert-butylphenyl)urea |
| InChIKey | ZUXJIOLLSSLCOH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=NOC2=N1)N)C3=CC=C(C=C3)NC(=O)NC4=CC=C(C=C4)C(C)(C)C |
Computed by PubChem (NCBI)