Products 2911610-03-0
CAS 2911610-03-0 appears in our catalog under these names: Anti-inflammatory agent 51/ 99.46% (existing batch purity), Anti–inflammatory agent 51, Anti-inflammatory agent 51, 98.08%, Anti-inflammatory agent 51. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
3-nitro-4-[4-(4-nitrophenyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)benzenesulfonamide (CAS 2911610-03-0) is a chemical compound with the molecular formula C22H22N6O6S and a molecular weight of 498.5 g/mol. IUPAC name: 3-nitro-4-[4-(4-nitrophenyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)benzenesulfonamide. InChIKey: OPKZZQWLEPMJKK-UHFFFAOYSA-N.
| Molecular formula | C22H22N6O6S |
|---|---|
| Molecular weight | 498.5 g/mol |
| IUPAC name | 3-nitro-4-[4-(4-nitrophenyl)piperazin-1-yl]-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| InChIKey | OPKZZQWLEPMJKK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)[N+](=O)[O-])C3=C(C=C(C=C3)S(=O)(=O)NCC4=CC=CC=N4)[N+](=O)[O-] |
Computed by PubChem (NCBI)