Products 2911613-35-7
CAS 2911613-35-7 is the registry number for E3 ligase Ligand 26. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,3,4,5,6-pentafluorophenyl) 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylbenzoate (CAS 2911613-35-7) is a chemical compound with the molecular formula C18H11F5N2O4 and a molecular weight of 414.3 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylbenzoate. InChIKey: VSUNLVYUXPSMBA-UHFFFAOYSA-N.
| Molecular formula | C18H11F5N2O4 |
|---|---|
| Molecular weight | 414.3 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylbenzoate |
| InChIKey | VSUNLVYUXPSMBA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F)N3CCC(=O)NC3=O |
Computed by PubChem (NCBI)