CAS 29118-61-4 appears in our catalog under these names: Fructose-proline (mixture of diastereomers), >95% (HPLC), Fructose–proline, Frucoste-proline, 1-DEOXY-1-L-PROLINE-D-FRUCTOSE, Fructose-proline. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 1mg, 10 mg.
(2S)-1-[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]pyrrolidine-2-carboxylic acid (CAS 29118-61-4) is a chemical compound with the molecular formula C11H19NO7 and a molecular weight of 277.27 g/mol. IUPAC name: (2S)-1-[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]pyrrolidine-2-carboxylic acid. InChIKey: QQBMYMKLRZUCDK-JZKKDOLYSA-N.
| Molecular formula | C11H19NO7 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | (2S)-1-[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]pyrrolidine-2-carboxylic acid |
| InChIKey | QQBMYMKLRZUCDK-JZKKDOLYSA-N |
| SMILES | C1C[C@H](N(C1)CC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O)C(=O)O |
Computed by PubChem (NCBI)