CAS 29118-70-5 appears in our catalog under these names: Cis,trans-5,9-cyclododecadiene-cis-1,2-diol, 95%, cis,trans–5,9–Cyclododecadiene–cis–1,2–diol, cis,trans-5,9-Cyclododecadiene-cis-1,2-diol, >98.0%(GC), cis,trans-5,9-Cyclododecadiene-cis-1,2-diol, ≥98%(GC), ≥98%(GC). Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 1g.
(1S,2R,5E,9Z)-cyclododeca-5,9-diene-1,2-diol (CAS 29118-70-5) is a chemical compound with the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. IUPAC name: (1S,2R,5E,9Z)-cyclododeca-5,9-diene-1,2-diol. InChIKey: BHYILZSOXKSYCF-NGSWUUQJSA-N.
| Molecular formula | C12H20O2 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | (1S,2R,5E,9Z)-cyclododeca-5,9-diene-1,2-diol |
| InChIKey | BHYILZSOXKSYCF-NGSWUUQJSA-N |
| SMILES | C\1C/C=C\CC[C@@H]([C@@H](CC/C=C1)O)O |
Computed by PubChem (NCBI)