CAS 29124-54-7 appears in our catalog under these names: 5-Chloro-2-methanesulfonylaniline, 97%, 5–Chloro–2–methanesulfonylaniline. Offered by: Combi-blocks, Chemat Brand, GLPBio. Available pack sizes: 10g, 5g, 1g, on request, 100mg.
5-chloro-2-methylsulfonylaniline (CAS 29124-54-7) is a chemical compound with the molecular formula C7H8ClNO2S and a molecular weight of 205.66 g/mol. IUPAC name: 5-chloro-2-methylsulfonylaniline. InChIKey: GZPZIEPSQSEDLT-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO2S |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | 5-chloro-2-methylsulfonylaniline |
| InChIKey | GZPZIEPSQSEDLT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)Cl)N |
Computed by PubChem (NCBI)