Products 2913192-39-7
CAS 2913192-39-7 is the registry number for ER degrader 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[4-[[2-(2,4-dimethylbenzoyl)-6-fluoro-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid (CAS 2913192-39-7) is a chemical compound with the molecular formula C26H19FO4S and a molecular weight of 446.5 g/mol. IUPAC name: (E)-3-[4-[[2-(2,4-dimethylbenzoyl)-6-fluoro-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid. InChIKey: LORPMLOKMAZOOA-WUXMJOGZSA-N.
| Molecular formula | C26H19FO4S |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | (E)-3-[4-[[2-(2,4-dimethylbenzoyl)-6-fluoro-1-benzothiophen-3-yl]oxy]phenyl]prop-2-enoic acid |
| InChIKey | LORPMLOKMAZOOA-WUXMJOGZSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C2=C(C3=C(S2)C=C(C=C3)F)OC4=CC=C(C=C4)/C=C/C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
ER degrader 4, orb1982554