CAS 2913194-20-2 is the registry number for Antiproliferative agent-52. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-N-(4-methoxyphenyl)-N-methylthieno[3,2-d]pyrimidin-4-amine (CAS 2913194-20-2) is a chemical compound with the molecular formula C14H12ClN3OS and a molecular weight of 305.8 g/mol. IUPAC name: 2-chloro-N-(4-methoxyphenyl)-N-methylthieno[3,2-d]pyrimidin-4-amine. InChIKey: HORXFYJUOOLKSX-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3OS |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | 2-chloro-N-(4-methoxyphenyl)-N-methylthieno[3,2-d]pyrimidin-4-amine |
| InChIKey | HORXFYJUOOLKSX-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)OC)C2=NC(=NC3=C2SC=C3)Cl |
Computed by PubChem (NCBI)