Products 2913219-09-5
CAS 2913219-09-5 is the registry number for tert-butyl 3'-bromo-5',7'-dihydro-4'H-spiro[cyclopropane-1,6'-pyrazolo[1,5-a]pyrazine]-5'-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl 3-bromospiro[4,7-dihydropyrazolo[1,5-a]pyrazine-6,1'-cyclopropane]-5-carboxylate (CAS 2913219-09-5) is a chemical compound with the molecular formula C13H18BrN3O2 and a molecular weight of 328.20 g/mol. IUPAC name: tert-butyl 3-bromospiro[4,7-dihydropyrazolo[1,5-a]pyrazine-6,1'-cyclopropane]-5-carboxylate. InChIKey: VKVVGPVNOXOLKU-UHFFFAOYSA-N.
| Molecular formula | C13H18BrN3O2 |
|---|---|
| Molecular weight | 328.20 g/mol |
| IUPAC name | tert-butyl 3-bromospiro[4,7-dihydropyrazolo[1,5-a]pyrazine-6,1'-cyclopropane]-5-carboxylate |
| InChIKey | VKVVGPVNOXOLKU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C=NN2CC13CC3)Br |
Computed by PubChem (NCBI)