CAS 2777118-41-7 is the registry number for tert-Butyl 3-amino-2-bromo-5,8-dihydro-1,7-naphthyridine-7(6H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-amino-2-bromo-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate (CAS 2777118-41-7) is a chemical compound with the molecular formula C13H18BrN3O2 and a molecular weight of 328.20 g/mol. IUPAC name: tert-butyl 3-amino-2-bromo-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate. InChIKey: WNKGTVTUKZAGNG-UHFFFAOYSA-N.
| Molecular formula | C13H18BrN3O2 |
|---|---|
| Molecular weight | 328.20 g/mol |
| IUPAC name | tert-butyl 3-amino-2-bromo-6,8-dihydro-5H-1,7-naphthyridine-7-carboxylate |
| InChIKey | WNKGTVTUKZAGNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=CC(=C(N=C2C1)Br)N |
Computed by PubChem (NCBI)