Products 2913241-10-6
CAS 2913241-10-6 is the registry number for 5-Phenyl-3-oxabicyclo[3.1.1]heptan-1-amine Hydrochloride, >95%. Offered by: Chemat. Available pack sizes: 100mg.
5-phenyl-3-oxabicyclo[3.1.1]heptan-1-amine;hydrochloride (CAS 2913241-10-6) is a chemical compound with the molecular formula C12H16ClNO and a molecular weight of 225.71 g/mol. IUPAC name: 5-phenyl-3-oxabicyclo[3.1.1]heptan-1-amine;hydrochloride. InChIKey: GJDDDZPGEBQJDN-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO |
|---|---|
| Molecular weight | 225.71 g/mol |
| IUPAC name | 5-phenyl-3-oxabicyclo[3.1.1]heptan-1-amine;hydrochloride |
| InChIKey | GJDDDZPGEBQJDN-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(COC2)N)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)