Products 2913267-72-6

CAS 2913267-72-6 is the registry number for 1-Cyano-3,3-difluorocyclobutane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

1-cyano-3,3-difluorocyclobutane-1-carboxylic acid (CAS 2913267-72-6) is a chemical compound with the molecular formula C6H5F2NO2 and a molecular weight of 161.11 g/mol. IUPAC name: 1-cyano-3,3-difluorocyclobutane-1-carboxylic acid. InChIKey: NDWIHLWZNLOVTE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5F2NO2
Molecular weight161.11 g/mol
IUPAC name1-cyano-3,3-difluorocyclobutane-1-carboxylic acid
InChIKeyNDWIHLWZNLOVTE-UHFFFAOYSA-N
SMILESC1C(CC1(F)F)(C#N)C(=O)O

Computed by PubChem (NCBI)