Products 2913572-78-6
CAS 2913572-78-6 is the registry number for 2-(4-Chloro-2-fluoro-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-(4-chloro-2-fluoro-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2913572-78-6) is a chemical compound with the molecular formula C13H17BClFO2 and a molecular weight of 270.54 g/mol. IUPAC name: 2-(4-chloro-2-fluoro-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WJFVZJUDMIWHMS-UHFFFAOYSA-N.
| Molecular formula | C13H17BClFO2 |
|---|---|
| Molecular weight | 270.54 g/mol |
| IUPAC name | 2-(4-chloro-2-fluoro-6-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WJFVZJUDMIWHMS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2C)Cl)F |
Computed by PubChem (NCBI)