Products 2914224-54-5
CAS 2914224-54-5 is the registry number for Antimalarial agent 9. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(6-bromo-2-methoxyquinolin-3-yl)-imidazol-1-ylmethyl]-2,6-ditert-butylphenol (CAS 2914224-54-5) is a chemical compound with the molecular formula C28H32BrN3O2 and a molecular weight of 522.5 g/mol. IUPAC name: 4-[(6-bromo-2-methoxyquinolin-3-yl)-imidazol-1-ylmethyl]-2,6-ditert-butylphenol. InChIKey: MXZOJCYUMGPERG-UHFFFAOYSA-N.
| Molecular formula | C28H32BrN3O2 |
|---|---|
| Molecular weight | 522.5 g/mol |
| IUPAC name | 4-[(6-bromo-2-methoxyquinolin-3-yl)-imidazol-1-ylmethyl]-2,6-ditert-butylphenol |
| InChIKey | MXZOJCYUMGPERG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C(C2=C(N=C3C=CC(=CC3=C2)Br)OC)N4C=CN=C4 |
Computed by PubChem (NCBI)
Synonyms:
Antimalarial agent 9