CAS 2914879-10-8 appears in our catalog under these names: KIF18A–IN–6, KIF18A-IN-6, 98%, KIF18A-IN-6, 98%, 98%, KIF18A-IN-6, 98.48%. Offered by: GLPBio, AmBeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 1mg, 5mg, 500 mg, 5 mg, 250 mg.
CAS 2914879-10-8 identifies a chemical compound with the molecular formula C28H37N3O5S2 and a molecular weight of 559.7 g/mol. InChIKey: AXRRVVWONHGXHG-UHFFFAOYSA-N.
| Molecular formula | C28H37N3O5S2 |
|---|---|
| Molecular weight | 559.7 g/mol |
| InChIKey | AXRRVVWONHGXHG-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)NC1=CC2=C(C=C1)N(CC23CCC4(CC4)CC3)C(=O)C5=CC(=CC=C5)S(=O)(=O)NC(C)(C)C |
Computed by PubChem (NCBI)