Products 2914921-97-2
CAS 2914921-97-2 is the registry number for (3,5-bis(Trifluoromethyl)phenyl)(phenyl)methanamine hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[3,5-bis(trifluoromethyl)phenyl]-phenylmethanamine;hydrochloride (CAS 2914921-97-2) is a chemical compound with the molecular formula C15H12ClF6N and a molecular weight of 355.70 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)phenyl]-phenylmethanamine;hydrochloride. InChIKey: IJKUCXOSFIAGGX-UHFFFAOYSA-N.
| Molecular formula | C15H12ClF6N |
|---|---|
| Molecular weight | 355.70 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)phenyl]-phenylmethanamine;hydrochloride |
| InChIKey | IJKUCXOSFIAGGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)