Products 2915-57-3
CAS 2915-57-3 appears in our catalog under these names: Butanedioic acid, 1,4-bis(2-ethylhexyl) ester, 95%, Bis(2-ethylhexyl) succinate, Bis(2-ethylhexyl) Succinate, >98.0%(GC), Bis(2-ethylhexyl) succinate 95%, Bis(2-ethylhexyl) succinate, 95%, 95%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 25mg, 50mg, 500mg, 1g.
Bis(2-ethylhexyl) butanedioate (CAS 2915-57-3) is a chemical compound with the molecular formula C20H38O4 and a molecular weight of 342.5 g/mol. IUPAC name: bis(2-ethylhexyl) butanedioate. InChIKey: WMNULTDOANGXRT-UHFFFAOYSA-N.
| Molecular formula | C20H38O4 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | bis(2-ethylhexyl) butanedioate |
| InChIKey | WMNULTDOANGXRT-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)CCC(=O)OCC(CC)CCCC |
Computed by PubChem (NCBI)