CAS 29150-63-8 appears in our catalog under these names: Benzo(1,2–b:3,4–b':5,6–b'')trithiophene, Benzo[1,2-b:3,4-b':5,6-b'']trithiophene, 96%, 96%, Benzo[1,2-b:3,4-b':5,6-b'']trithiophene, 96%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 50mg.
3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene (CAS 29150-63-8) is a chemical compound with the molecular formula C12H6S3 and a molecular weight of 246.4 g/mol. IUPAC name: 3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene. InChIKey: DKSAJSCNXULKER-UHFFFAOYSA-N.
| Molecular formula | C12H6S3 |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | 3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene |
| InChIKey | DKSAJSCNXULKER-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C3=C(C=CS3)C4=C2C=CS4 |
Computed by PubChem (NCBI)