Products 291533-11-4
CAS 291533-11-4 appears in our catalog under these names: PG-116800/ 98.02% (existing batch purity), PG 116800, PG 116800, 99.81%, PG 116800. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
2-[[4-[(4-methoxybenzoyl)amino]phenyl]sulfonylamino]-6-morpholin-4-ylhex-4-ynoic acid (CAS 291533-11-4) is a chemical compound with the molecular formula C24H27N3O7S and a molecular weight of 501.6 g/mol. IUPAC name: 2-[[4-[(4-methoxybenzoyl)amino]phenyl]sulfonylamino]-6-morpholin-4-ylhex-4-ynoic acid. InChIKey: JAYVKNDQKXUNOJ-UHFFFAOYSA-N.
| Molecular formula | C24H27N3O7S |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 2-[[4-[(4-methoxybenzoyl)amino]phenyl]sulfonylamino]-6-morpholin-4-ylhex-4-ynoic acid |
| InChIKey | JAYVKNDQKXUNOJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)S(=O)(=O)NC(CC#CCN3CCOCC3)C(=O)O |
Computed by PubChem (NCBI)