Products 2915559-21-4
CAS 2915559-21-4 is the registry number for 2,4,6-Trichloro-5-(dimethoxymethyl)pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-trichloro-5-(dimethoxymethyl)pyrimidine (CAS 2915559-21-4) is a chemical compound with the molecular formula C7H7Cl3N2O2 and a molecular weight of 257.5 g/mol. IUPAC name: 2,4,6-trichloro-5-(dimethoxymethyl)pyrimidine. InChIKey: OCJXERIYOCNZER-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl3N2O2 |
|---|---|
| Molecular weight | 257.5 g/mol |
| IUPAC name | 2,4,6-trichloro-5-(dimethoxymethyl)pyrimidine |
| InChIKey | OCJXERIYOCNZER-UHFFFAOYSA-N |
| SMILES | COC(C1=C(N=C(N=C1Cl)Cl)Cl)OC |
Computed by PubChem (NCBI)