CAS 2915675-58-8 is the registry number for SORT1-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-5,5-dimethyl-2-[(1-methylindol-4-yl)methylamino]hexanoic acid;hydrochloride (CAS 2915675-58-8) is a chemical compound with the molecular formula C18H27ClN2O2 and a molecular weight of 338.9 g/mol. IUPAC name: (2S)-5,5-dimethyl-2-[(1-methylindol-4-yl)methylamino]hexanoic acid;hydrochloride. InChIKey: QFDKOSVWHLBIAF-RSAXXLAASA-N.
| Molecular formula | C18H27ClN2O2 |
|---|---|
| Molecular weight | 338.9 g/mol |
| IUPAC name | (2S)-5,5-dimethyl-2-[(1-methylindol-4-yl)methylamino]hexanoic acid;hydrochloride |
| InChIKey | QFDKOSVWHLBIAF-RSAXXLAASA-N |
| SMILES | CC(C)(C)CC[C@@H](C(=O)O)NCC1=C2C=CN(C2=CC=C1)C.Cl |
Computed by PubChem (NCBI)