Products 2916866-89-0
CAS 2916866-89-0 is the registry number for ((1AS,6bR)-hexahydrocyclopropa[a]pyrrolizin-6a(4H)-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,4S)-6-azatricyclo[4.3.0.02,4]nonan-1-yl]methanol (CAS 2916866-89-0) is a chemical compound with the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. IUPAC name: [(2R,4S)-6-azatricyclo[4.3.0.02,4]nonan-1-yl]methanol. InChIKey: IDXKJRQMYZLFAY-ZAZKALAHSA-N.
| Molecular formula | C9H15NO |
|---|---|
| Molecular weight | 153.22 g/mol |
| IUPAC name | [(2R,4S)-6-azatricyclo[4.3.0.02,4]nonan-1-yl]methanol |
| InChIKey | IDXKJRQMYZLFAY-ZAZKALAHSA-N |
| SMILES | C1CC2([C@@H]3C[C@@H]3CN2C1)CO |
Computed by PubChem (NCBI)