CAS 2917520-15-9 is the registry number for 8-Bromo-3,7-difluoro-6H-isochromeno[3,4-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-3,7-difluoro-6H-isochromeno[3,4-b]pyridine (CAS 2917520-15-9) is a chemical compound with the molecular formula C12H6BrF2NO and a molecular weight of 298.08 g/mol. IUPAC name: 8-bromo-3,7-difluoro-6H-isochromeno[3,4-b]pyridine. InChIKey: SKRVDUYWSBDJHK-UHFFFAOYSA-N.
| Molecular formula | C12H6BrF2NO |
|---|---|
| Molecular weight | 298.08 g/mol |
| IUPAC name | 8-bromo-3,7-difluoro-6H-isochromeno[3,4-b]pyridine |
| InChIKey | SKRVDUYWSBDJHK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2F)Br)C3=C(O1)N=C(C=C3)F |
Computed by PubChem (NCBI)