CAS 291778-50-2 appears in our catalog under these names: (2S,3S)-3-Amino-1,1,1-trifluoro-4-methylpentan-2-ol, 95%, (2S,3S)-3-Amino-1,1,1-trifluoro-4-methylpentan-2-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
(2S,3S)-3-amino-1,1,1-trifluoro-4-methylpentan-2-ol (CAS 291778-50-2) is a chemical compound with the molecular formula C6H12F3NO and a molecular weight of 171.16 g/mol. IUPAC name: (2S,3S)-3-amino-1,1,1-trifluoro-4-methylpentan-2-ol. InChIKey: CXXBVHOIDJALEU-WHFBIAKZSA-N.
| Molecular formula | C6H12F3NO |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | (2S,3S)-3-amino-1,1,1-trifluoro-4-methylpentan-2-ol |
| InChIKey | CXXBVHOIDJALEU-WHFBIAKZSA-N |
| SMILES | CC(C)[C@@H]([C@@H](C(F)(F)F)O)N |
Computed by PubChem (NCBI)