CAS 2918766-35-3 is the registry number for 7-Bromo-2,4,6-trichloro-3-nitro-1,5-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2,4,6-trichloro-3-nitro-1,5-naphthyridine (CAS 2918766-35-3) is a chemical compound with the molecular formula C8HBrCl3N3O2 and a molecular weight of 357.4 g/mol. IUPAC name: 7-bromo-2,4,6-trichloro-3-nitro-1,5-naphthyridine. InChIKey: WIYHWKBRBBKBDU-UHFFFAOYSA-N.
| Molecular formula | C8HBrCl3N3O2 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 7-bromo-2,4,6-trichloro-3-nitro-1,5-naphthyridine |
| InChIKey | WIYHWKBRBBKBDU-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Br)Cl)C(=C(C(=N2)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)