CAS 2918766-65-9 is the registry number for 6,7,8-Trichloro-4-hydroxy-1,5-naphthyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7,8-trichloro-4-hydroxy-1H-1,5-naphthyridin-2-one (CAS 2918766-65-9) is a chemical compound with the molecular formula C8H3Cl3N2O2 and a molecular weight of 265.5 g/mol. IUPAC name: 6,7,8-trichloro-4-hydroxy-1H-1,5-naphthyridin-2-one. InChIKey: WEZIEFUVHJSRNY-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2O2 |
|---|---|
| Molecular weight | 265.5 g/mol |
| IUPAC name | 6,7,8-trichloro-4-hydroxy-1H-1,5-naphthyridin-2-one |
| InChIKey | WEZIEFUVHJSRNY-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C(C(=N2)Cl)Cl)Cl)NC1=O)O |
Computed by PubChem (NCBI)