CAS 2918778-18-2 is the registry number for (1R,4R)-tert-Butyl 5-benzyl-6-cyano-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R,4R)-5-benzyl-6-cyano-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (CAS 2918778-18-2) is a chemical compound with the molecular formula C18H23N3O2 and a molecular weight of 313.4 g/mol. IUPAC name: tert-butyl (1R,4R)-5-benzyl-6-cyano-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: USMKPTUECHIFBQ-YGFGXBMJSA-N.
| Molecular formula | C18H23N3O2 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | tert-butyl (1R,4R)-5-benzyl-6-cyano-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | USMKPTUECHIFBQ-YGFGXBMJSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@H]1C(N2CC3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)