CAS 2173146-34-2 appears in our catalog under these names: Saxagliptin Impurity 34 discontinued see RM-S120726, Saxagliptin Impurity 61, 3-Deshydroxy 3-Keto Saxagliptin. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1S,3S,5S)-2-[(2S)-2-amino-2-(4-oxo-1-adamantyl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile (CAS 2173146-34-2) is a chemical compound with the molecular formula C18H23N3O2 and a molecular weight of 313.4 g/mol. IUPAC name: (1S,3S,5S)-2-[(2S)-2-amino-2-(4-oxo-1-adamantyl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile. InChIKey: NTCXLTRMAHTPRH-IKIWYEBXSA-N.
| Molecular formula | C18H23N3O2 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | (1S,3S,5S)-2-[(2S)-2-amino-2-(4-oxo-1-adamantyl)acetyl]-2-azabicyclo[3.1.0]hexane-3-carbonitrile |
| InChIKey | NTCXLTRMAHTPRH-IKIWYEBXSA-N |
| SMILES | C1[C@@H]2C[C@@H]2N([C@@H]1C#N)C(=O)[C@H](C34CC5CC(C3)C(=O)C(C5)C4)N |
Computed by PubChem (NCBI)