Products 2918829-48-6
CAS 2918829-48-6 is the registry number for 1-(5-chloro-2-fluoro-4-methylphenyl)cyclopentanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(5-chloro-2-fluoro-4-methylphenyl)cyclopentan-1-ol (CAS 2918829-48-6) is a chemical compound with the molecular formula C12H14ClFO and a molecular weight of 228.69 g/mol. IUPAC name: 1-(5-chloro-2-fluoro-4-methylphenyl)cyclopentan-1-ol. InChIKey: NOZNCQZIPUPNJW-UHFFFAOYSA-N.
| Molecular formula | C12H14ClFO |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | 1-(5-chloro-2-fluoro-4-methylphenyl)cyclopentan-1-ol |
| InChIKey | NOZNCQZIPUPNJW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C2(CCCC2)O)F |
Computed by PubChem (NCBI)