Products 2918831-30-6

CAS 2918831-30-6 is the registry number for tert-butyl 2,6-difluoro-4-(methylthio)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,6-difluoro-4-methylsulfanylbenzoate (CAS 2918831-30-6) is a chemical compound with the molecular formula C12H14F2O2S and a molecular weight of 260.30 g/mol. IUPAC name: tert-butyl 2,6-difluoro-4-methylsulfanylbenzoate. InChIKey: KIXIMPCPCZUCTM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14F2O2S
Molecular weight260.30 g/mol
IUPAC nametert-butyl 2,6-difluoro-4-methylsulfanylbenzoate
InChIKeyKIXIMPCPCZUCTM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(C=C(C=C1F)SC)F

Computed by PubChem (NCBI)