Products 2918848-98-1
CAS 2918848-98-1 is the registry number for 1-bromo-3,5-dichloro-4-(methoxymethoxy)-2-methylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3,5-dichloro-4-(methoxymethoxy)-2-methylbenzene (CAS 2918848-98-1) is a chemical compound with the molecular formula C9H9BrCl2O2 and a molecular weight of 299.97 g/mol. IUPAC name: 1-bromo-3,5-dichloro-4-(methoxymethoxy)-2-methylbenzene. InChIKey: GEJISUDVHXSNKD-UHFFFAOYSA-N.
| Molecular formula | C9H9BrCl2O2 |
|---|---|
| Molecular weight | 299.97 g/mol |
| IUPAC name | 1-bromo-3,5-dichloro-4-(methoxymethoxy)-2-methylbenzene |
| InChIKey | GEJISUDVHXSNKD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Cl)OCOC)Cl)Br |
Computed by PubChem (NCBI)