CAS 2918863-44-0 is the registry number for 1-(3-chloro-2,4-difluorophenyl)cyclohexanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-chloro-2,4-difluorophenyl)cyclohexan-1-ol (CAS 2918863-44-0) is a chemical compound with the molecular formula C12H13ClF2O and a molecular weight of 246.68 g/mol. IUPAC name: 1-(3-chloro-2,4-difluorophenyl)cyclohexan-1-ol. InChIKey: AWRBRIYFJGRVPU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF2O |
|---|---|
| Molecular weight | 246.68 g/mol |
| IUPAC name | 1-(3-chloro-2,4-difluorophenyl)cyclohexan-1-ol |
| InChIKey | AWRBRIYFJGRVPU-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=C(C(=C(C=C2)F)Cl)F)O |
Computed by PubChem (NCBI)