CAS 2918865-93-5 is the registry number for Ethyl 3-(3,5-dibromophenyl)-3-hydroxypropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(3,5-dibromophenyl)-3-hydroxypropanoate (CAS 2918865-93-5) is a chemical compound with the molecular formula C11H12Br2O3 and a molecular weight of 352.02 g/mol. IUPAC name: ethyl 3-(3,5-dibromophenyl)-3-hydroxypropanoate. InChIKey: DDOYXXIJMPDOIB-UHFFFAOYSA-N.
| Molecular formula | C11H12Br2O3 |
|---|---|
| Molecular weight | 352.02 g/mol |
| IUPAC name | ethyl 3-(3,5-dibromophenyl)-3-hydroxypropanoate |
| InChIKey | DDOYXXIJMPDOIB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=CC(=CC(=C1)Br)Br)O |
Computed by PubChem (NCBI)