Products 2918900-72-6
CAS 2918900-72-6 is the registry number for 4-fluoro-3-(1-hydroxycyclobutyl)benzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-fluoro-3-(1-hydroxycyclobutyl)benzonitrile (CAS 2918900-72-6) is a chemical compound with the molecular formula C11H10FNO and a molecular weight of 191.20 g/mol. IUPAC name: 4-fluoro-3-(1-hydroxycyclobutyl)benzonitrile. InChIKey: OZBZPLQSFBJWJA-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | 4-fluoro-3-(1-hydroxycyclobutyl)benzonitrile |
| InChIKey | OZBZPLQSFBJWJA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=C(C=CC(=C2)C#N)F)O |
Computed by PubChem (NCBI)