Products 2918902-98-2
CAS 2918902-98-2 is the registry number for 2-(5-bromo-2,4-dichlorophenyl)-2-methyl-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(5-bromo-2,4-dichlorophenyl)-2-methyl-1,3-dioxolane (CAS 2918902-98-2) is a chemical compound with the molecular formula C10H9BrCl2O2 and a molecular weight of 311.98 g/mol. IUPAC name: 2-(5-bromo-2,4-dichlorophenyl)-2-methyl-1,3-dioxolane. InChIKey: NQXGKXKNQWRCDY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrCl2O2 |
|---|---|
| Molecular weight | 311.98 g/mol |
| IUPAC name | 2-(5-bromo-2,4-dichlorophenyl)-2-methyl-1,3-dioxolane |
| InChIKey | NQXGKXKNQWRCDY-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=CC(=C(C=C2Cl)Cl)Br |
Computed by PubChem (NCBI)